| 
 | 
                        Produktdetails:
                                                     
 
 | 
| Produktname: | CI 50206 | CAS: | 4569-86-2 | 
|---|---|---|---|
| Bilden: | solide | Farbe: | Von sehr dunkelblau bis schwarz | 
| Speichertemperatur.: | Zimmertemperatur | Eincs: | 610-268-6 | 
| Schmelzpunkt: | 285 °C (Dez.) | ||
| Hervorheben: | CAS 4569-86-2 biological reagents,CI 50206 industrial fine chemicals,biological reagents with warranty | ||
CAS CI 50206 Fuchsin Acid biological reagents
| Product Name: | CI 50206 | 
| Synonyms: | Methylene violet 3rax, pure;2-Amino-8-(diethylamino)-10-phenylphenazine-10-ium·chloride;3-Amino-7-(diethylamino)-5-phenyl phenazinium chloride, 3-Amino-7-(diethylamino)-5-phenylphenazinium chloride, N,N-Diethylphenosafranine;Methylene violet 3RAX, Dye content 90%;PhenaziniuM,3-aMino-7-(diethylaMino)-5-phenyl-, chloride (1:1);N,N-DIETHYLPHENOSAFRANINE;Phenazinium,3-amino-7-(diethylamino)-5-phenyl-,chloride;3-AMINO-7-DIETHYLAMINO-5-PHENYL-PHENAZIN-5-IUM CHLORIDE | 
| CAS: | 4569-86-2 | 
| MF: | C22H23ClN4 | 
| MW: | 378.9 | 
| EINECS: | 610-268-6 | 
| Product Categories: | |
| Mol File: | 4569-86-2.mol | 
|  | |
| CI 50206 Chemical Properties | 
| Melting point | 285 °C (dec.)(lit.) | 
| storage temp. | room temp | 
| solubility | DMSO (Slightly), Methanol (Slightly) | 
| form | Solid | 
| Colour Index | 50206 | 
| color | Very Dark Blue to Black | 
| λmax | 557 nm | 
| InChI | InChI=1S/C22H22N4.ClH/c1-3-25(4-2)18-11-13-20-22(15-18)26(17-8-6-5-7-9-17)21-14-16(23)10-12-19(21)24-20;/h5-15,23H,3-4H2,1-2H3;1H | 
| InChIKey | MOVNSGGBTSIUGX-UHFFFAOYSA-N | 
| SMILES | N(C1C=CC2=NC3=CC=C(N)C=C3[N+](C3C=CC=CC=3)=C2C=1)(CC)CC.[Cl-] | 
| CAS DataBase Reference | 4569-86-2(CAS DataBase Reference) | 

Ansprechpartner: Maggie Ma
Telefon: +0086 188 7414 9531