|
Produktdetails:
|
| Produktname: | Artesunate | CAS: | 88495-63-0 |
|---|---|---|---|
| Einecs: | 618-170-5 | Schmelzpunkt: | 132–1350 °C |
| Speichertemperatur.: | 2-8 ° C. | Bilden: | kristallines Pulver |
| Farbe: | Weiß bis knapp weiß | ||
| Hervorheben: | Artesunate biochemical lab reagent,CAS 88495-63-0 Artesunate,Industrial fine chemical Artesunate |
||
CAS 88495-63-0 Artesunate biochemical reagent for labs
| Product Name: | Artesunate |
| Synonyms: | ARTENSUNATE;Butanedioic acid, 1-[(3R,5aS,6R,8aS,9R,10S,12R,12aR)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl] ester;Artesunate (3R,5aS,6R,8aS,9R,10S,12R,12aR)-Decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano(4,3-j)-1,2-benzodioxepin-10-ol hydrogen succinate;ARTESUNATE;ArtesunateC19H28O8;Artemisinin monosuccinate;Artesunic Acid;Butanedioic Acid Mono(3R,5aS,6R,8aS,9R,10R,12R,12aR)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl] Ester |
| CAS: | 88495-63-0 |
| MF: | C19H28O8 |
| MW: | 384.42 |
| EINECS: | 618-170-5 |
| Product Categories: | natural product;Antimalarial;Inhibitors;Herb extract;plant extract;Natural Plant Extract;Intermediates & Fine Chemicals;Pharmaceuticals;Active Pharmaceutical Ingredients;88495-63-0 |
| Mol File: | 88495-63-0.mol |
| Artesunate Chemical Properties |
| Melting point | 132-1350C |
| Boiling point | 431.1°C (rough estimate) |
| density | 1.2076 (rough estimate) |
| refractive index | 1.4430 (estimate) |
| Fp | 173.5° |
| storage temp. | 2-8°C |
| solubility | ,: soluble33.4mg/mL |
| pka | 4.28±0.17(Predicted) |
| form | crystalline powder |
| color | white to off-white |
| biological source | Artemisia annua |
| Merck | 14,818 |
| BCS Class | 3/1 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 1 month. |
| InChIKey | FIHJKUPKCHIPAT-AHIGJZGOSA-N |
| SMILES | C(O[C@@H]1O[C@]2([H])O[C@@]3(C)CC[C@@]4([H])[C@H](C)CC[C@@]([H])([C@H]1C)[C@]42OO3)(=O)CCC(O)=O |
| LogP | 3.291 (est) |
![]()
Ansprechpartner: Maggie Ma
Telefon: +0086 188 7414 9531